C21H25N9 — CID 88587277
(Z)-[(7R)-7-ethyl-6-methylidene-8-propan-2-yl-2-(5-pyridin-2-yl-1H-pyrazol-4-yl)-7H-pteridin-5-yl]methylidenehydrazine (PubChem CID 88587277) has the molecular formula C21H25N9 and a molecular weight of 403.49 g/mol. Its IUPAC name is (Z)-[(7R)-7-ethyl-6-methylidene-8-propan-2-yl-2-(5-pyridin-2-yl-1H-pyrazol-4-yl)-7H-pteridin-5-yl]methylidenehydrazine.
| Compound Name | (Z)-[(7R)-7-ethyl-6-methylidene-8-propan-2-yl-2-(5-pyridin-2-yl-1H-pyrazol-4-yl)-7H-pteridin-5-yl]methylidenehydrazine |
|---|---|
| PubChem CID | 88587277 |
| Molecular Formula | C21H25N9 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (Z)-[(7R)-7-ethyl-6-methylidene-8-propan-2-yl-2-(5-pyridin-2-yl-1H-pyrazol-4-yl)-7H-pteridin-5-yl]methylidenehydrazine |
| SMILES | C=C1[C@@H](CC)N(C(C)C)c2nc(-c3cn[nH]c3-c3ccccn3)ncc2N1/C=N\N |
| InChI | InChI=1S/C21H25N9/c1-5-17-14(4)29(12-25-22)18-11-24-20(27-21(18)30(17)13(2)3)15-10-26-28-19(15)16-8-6-7-9-23-16/h6-13,17H,4-5,22H2,1-3H3,(H,26,28)/b25-12-/t17-/m1/s1 |
| InChIKey | OGLQKMNXLHAWKX-VXHGTMSESA-N |
| XLogP | 3.16 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|