About 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole
8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole (PubChem CID 88587524) has the molecular formula C24H22N2O3S
and a molecular weight of 418.52 g/mol. Its IUPAC name is 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole |
| PubChem CID | 88587524 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole |
| SMILES | C#CCCOc1ccc(-c2cccc(S(=O)(=O)CC)c2)c2c1[nH]c1ncc(C)cc12 |
| InChI | InChI=1S/C24H22N2O3S/c1-4-6-12-29-21-11-10-19(17-8-7-9-18(14-17)30(27,28)5-2)22-20-13-16(3)15-25-24(20)26-23(21)22/h1,7-11,13-15H,5-6,12H2,2-3H3,(H,25,26) |
| InChIKey | RGWYTRWTFPHPOX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole?
The IUPAC name of 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole (CID 88587524) is 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole?
The canonical SMILES for 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole is C#CCCOc1ccc(-c2cccc(S(=O)(=O)CC)c2)c2c1[nH]c1ncc(C)cc12.
What is the InChIKey of 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole?
The InChIKey is RGWYTRWTFPHPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O3S/c1-4-6-12-29-21-11-10-19(17-8-7-9-18(14-17)30(27,28)5-2)22-20-13-16(3)15-25-24(20)26-23(21)22/h1,7-11,13-15H,5-6,12H2,2-3H3,(H,25,26).
What are the key properties of 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole?
8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole has a molecular weight of 418.52 g/mol, XLogP of 4.89, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-but-3-ynoxy-5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 88587524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).