About N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide
N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide (PubChem CID 88587666) has the molecular formula C15H16N2O3
and a molecular weight of 272.30 g/mol. Its IUPAC name is N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide.
Molecular Properties
| Compound Name | N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide |
| PubChem CID | 88587666 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide |
| SMILES | O=CNc1cc2cccnc2cc1O[C@@H]1CC[C@@H](O)C1 |
| InChI | InChI=1S/C15H16N2O3/c18-9-17-14-6-10-2-1-5-16-13(10)8-15(14)20-12-4-3-11(19)7-12/h1-2,5-6,8-9,11-12,19H,3-4,7H2,(H,17,18)/t11-,12-/m1/s1 |
| InChIKey | FJTYEOSOFPCOCT-VXGBXAGGSA-N |
| XLogP | 2.10 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide?
The IUPAC name of N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide (CID 88587666) is N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide.
What is the SMILES notation for N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide?
The canonical SMILES for N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide is O=CNc1cc2cccnc2cc1O[C@@H]1CC[C@@H](O)C1.
What is the InChIKey of N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide?
The InChIKey is FJTYEOSOFPCOCT-VXGBXAGGSA-N. The full InChI is InChI=1S/C15H16N2O3/c18-9-17-14-6-10-2-1-5-16-13(10)8-15(14)20-12-4-3-11(19)7-12/h1-2,5-6,8-9,11-12,19H,3-4,7H2,(H,17,18)/t11-,12-/m1/s1.
What are the key properties of N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide?
N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide has a molecular weight of 272.30 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-[(1R,3R)-3-hydroxycyclopentyl]oxyquinolin-6-yl]formamide is sourced from PubChem (CID 88587666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).