C19H20FN3O2S — CID 88587837
6-fluoro-3-[3-(4-methoxy-N-methylanilino)propyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 88587837) has the molecular formula C19H20FN3O2S and a molecular weight of 373.45 g/mol. Its IUPAC name is 6-fluoro-3-[3-(4-methoxy-N-methylanilino)propyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 6-fluoro-3-[3-(4-methoxy-N-methylanilino)propyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 88587837 |
| Molecular Formula | C19H20FN3O2S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 6-fluoro-3-[3-(4-methoxy-N-methylanilino)propyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | COc1ccc(N(C)CCCn2c(=S)[nH]c3ccc(F)cc3c2=O)cc1 |
| InChI | InChI=1S/C19H20FN3O2S/c1-22(14-5-7-15(25-2)8-6-14)10-3-11-23-18(24)16-12-13(20)4-9-17(16)21-19(23)26/h4-9,12H,3,10-11H2,1-2H3,(H,21,26) |
| InChIKey | ROKQHKMMHMWZEV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|