C20H18N4O2 — CID 88587861
(2E)-N,2-dimethyl-4-[5-(1,2,4-oxadiazol-3-yl)-3-pyridinyl]-N-phenylpenta-2,4-dienamide (PubChem CID 88587861) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is (2E)-N,2-dimethyl-4-[5-(1,2,4-oxadiazol-3-yl)-3-pyridinyl]-N-phenylpenta-2,4-dienamide.
| Compound Name | (2E)-N,2-dimethyl-4-[5-(1,2,4-oxadiazol-3-yl)-3-pyridinyl]-N-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 88587861 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2E)-N,2-dimethyl-4-[5-(1,2,4-oxadiazol-3-yl)-3-pyridinyl]-N-phenylpenta-2,4-dienamide |
| SMILES | C=C(/C=C(\C)C(=O)N(C)c1ccccc1)c1cncc(-c2ncon2)c1 |
| InChI | InChI=1S/C20H18N4O2/c1-14(16-10-17(12-21-11-16)19-22-13-26-23-19)9-15(2)20(25)24(3)18-7-5-4-6-8-18/h4-13H,1H2,2-3H3/b15-9+ |
| InChIKey | ZDKHDFFYCUAWBB-OQLLNIDSSA-N |
| XLogP | 3.75 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|