C37H47Cl2NO7Si — CID 88587904
benzyl 4-[4-[2-(2,6-dichlorophenoxy)ethoxy]phenyl]-3-(ethylperoxymethyl)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 88587904) has the molecular formula C37H47Cl2NO7Si and a molecular weight of 716.78 g/mol. Its IUPAC name is benzyl 4-[4-[2-(2,6-dichlorophenoxy)ethoxy]phenyl]-3-(ethylperoxymethyl)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl 4-[4-[2-(2,6-dichlorophenoxy)ethoxy]phenyl]-3-(ethylperoxymethyl)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 88587904 |
| Molecular Formula | C37H47Cl2NO7Si |
| Molecular Weight | 716.78 g/mol |
| Exact Mass | 715.25 |
| IUPAC Name | benzyl 4-[4-[2-(2,6-dichlorophenoxy)ethoxy]phenyl]-3-(ethylperoxymethyl)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOOCC1CN(C(=O)OCc2ccccc2)C(CCC(C)(C)[Si](C)(C)O)C=C1c1ccc(OCCOc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C37H47Cl2NO7Si/c1-6-46-47-26-29-24-40(36(41)45-25-27-11-8-7-9-12-27)30(19-20-37(2,3)48(4,5)42)23-32(29)28-15-17-31(18-16-28)43-21-22-44-35-33(38)13-10-14-34(35)39/h7-18,23,29-30,42H,6,19-22,24-26H2,1-5H3 |
| InChIKey | HNEQWLWTLGUDHT-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.78 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|