C11H20F3N — CID 88588161
(Z)-1,1,1-trifluoro-N,8-dimethylnon-5-en-2-amine (PubChem CID 88588161) has the molecular formula C11H20F3N and a molecular weight of 223.28 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-N,8-dimethylnon-5-en-2-amine.
| Compound Name | (Z)-1,1,1-trifluoro-N,8-dimethylnon-5-en-2-amine |
|---|---|
| PubChem CID | 88588161 |
| Molecular Formula | C11H20F3N |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | (Z)-1,1,1-trifluoro-N,8-dimethylnon-5-en-2-amine |
| SMILES | CNC(CC/C=C\CC(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H20F3N/c1-9(2)7-5-4-6-8-10(15-3)11(12,13)14/h4-5,9-10,15H,6-8H2,1-3H3/b5-4- |
| InChIKey | YVAFZCLHVOKBPK-PLNGDYQASA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|