C26H29F2N3O3 — CID 88588391
4-[(3E,4E)-4-[(Z)-2-aminoprop-1-enyl]-1-(2,4-difluorophenyl)-3-hydroxyiminohepta-4,6-dienyl]-N-[(2R)-2-hydroxypropyl]benzamide (PubChem CID 88588391) has the molecular formula C26H29F2N3O3 and a molecular weight of 469.53 g/mol. Its IUPAC name is 4-[(3E,4E)-4-[(Z)-2-aminoprop-1-enyl]-1-(2,4-difluorophenyl)-3-hydroxyiminohepta-4,6-dienyl]-N-[(2R)-2-hydroxypropyl]benzamide.
| Compound Name | 4-[(3E,4E)-4-[(Z)-2-aminoprop-1-enyl]-1-(2,4-difluorophenyl)-3-hydroxyiminohepta-4,6-dienyl]-N-[(2R)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 88588391 |
| Molecular Formula | C26H29F2N3O3 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 4-[(3E,4E)-4-[(Z)-2-aminoprop-1-enyl]-1-(2,4-difluorophenyl)-3-hydroxyiminohepta-4,6-dienyl]-N-[(2R)-2-hydroxypropyl]benzamide |
| SMILES | C=C/C=C(\C=C(\C)N)C(/CC(c1ccc(C(=O)NC[C@@H](C)O)cc1)c1ccc(F)cc1F)=N/O |
| InChI | InChI=1S/C26H29F2N3O3/c1-4-5-20(12-16(2)29)25(31-34)14-23(22-11-10-21(27)13-24(22)28)18-6-8-19(9-7-18)26(33)30-15-17(3)32/h4-13,17,23,32,34H,1,14-15,29H2,2-3H3,(H,30,33)/b16-12-,20-5+,31-25+/t17-,23?/m1/s1 |
| InChIKey | XKMUTLHSNBYFKT-AZZGAQNFSA-N |
| XLogP | 4.40 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|