About (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol
(E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol (PubChem CID 88588585) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol.
Molecular Properties
| Compound Name | (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol |
| PubChem CID | 88588585 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol |
| SMILES | CCCC(CCC/C=C(\C)C(C)O)C(C)C(O)OC |
| InChI | InChI=1S/C16H32O3/c1-6-9-15(13(3)16(18)19-5)11-8-7-10-12(2)14(4)17/h10,13-18H,6-9,11H2,1-5H3/b12-10+ |
| InChIKey | GEELFTXSHIYBSM-ZRDIBKRKSA-N |
| XLogP | 3.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol?
The IUPAC name of (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol (CID 88588585) is (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol.
What is the SMILES notation for (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol?
The canonical SMILES for (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol is CCCC(CCC/C=C(\C)C(C)O)C(C)C(O)OC.
What is the InChIKey of (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol?
The InChIKey is GEELFTXSHIYBSM-ZRDIBKRKSA-N. The full InChI is InChI=1S/C16H32O3/c1-6-9-15(13(3)16(18)19-5)11-8-7-10-12(2)14(4)17/h10,13-18H,6-9,11H2,1-5H3/b12-10+.
What are the key properties of (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol?
(E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol has a molecular weight of 272.43 g/mol, XLogP of 3.50, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-methoxy-2,8-dimethyl-3-propyldec-7-ene-1,9-diol is sourced from PubChem (CID 88588585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).