C16H33NO — CID 88588672
1-[[(3R)-2,4-dimethylpent-1-en-3-yl]amino]-3-ethyl-5-methylhexan-1-ol (PubChem CID 88588672) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is 1-[[(3R)-2,4-dimethylpent-1-en-3-yl]amino]-3-ethyl-5-methylhexan-1-ol.
| Compound Name | 1-[[(3R)-2,4-dimethylpent-1-en-3-yl]amino]-3-ethyl-5-methylhexan-1-ol |
|---|---|
| PubChem CID | 88588672 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 1-[[(3R)-2,4-dimethylpent-1-en-3-yl]amino]-3-ethyl-5-methylhexan-1-ol |
| SMILES | C=C(C)[C@H](NC(O)CC(CC)CC(C)C)C(C)C |
| InChI | InChI=1S/C16H33NO/c1-8-14(9-11(2)3)10-15(18)17-16(12(4)5)13(6)7/h11,13-18H,4,8-10H2,1-3,5-7H3/t14?,15?,16-/m0/s1 |
| InChIKey | XMOUZVDRJRCUEQ-GPANFISMSA-N |
| XLogP | 3.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|