C9H11F3O3S — CID 88589064
(2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-diene-1-sulfonic acid (PubChem CID 88589064) has the molecular formula C9H11F3O3S and a molecular weight of 256.25 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-diene-1-sulfonic acid.
| Compound Name | (2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 88589064 |
| Molecular Formula | C9H11F3O3S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | (2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-diene-1-sulfonic acid |
| SMILES | C=C/C(=C\C=C(/C)C(F)(F)F)CS(=O)(=O)O |
| InChI | InChI=1S/C9H11F3O3S/c1-3-8(6-16(13,14)15)5-4-7(2)9(10,11)12/h3-5H,1,6H2,2H3,(H,13,14,15)/b7-4+,8-5+ |
| InChIKey | TZVCHKIAQHNNBP-NSLJXJERSA-N |
| XLogP | 2.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|