About 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole
1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole (PubChem CID 88589108) has the molecular formula C7H12FN
and a molecular weight of 129.18 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole |
| PubChem CID | 88589108 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole |
| SMILES | CC1=CCN(CCF)C1 |
| InChI | InChI=1S/C7H12FN/c1-7-2-4-9(6-7)5-3-8/h2H,3-6H2,1H3 |
| InChIKey | VSMJWVKNPPOEQM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole?
The IUPAC name of 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole (CID 88589108) is 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole.
What is the SMILES notation for 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole?
The canonical SMILES for 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole is CC1=CCN(CCF)C1.
What is the InChIKey of 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole?
The InChIKey is VSMJWVKNPPOEQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FN/c1-7-2-4-9(6-7)5-3-8/h2H,3-6H2,1H3.
What are the key properties of 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole?
1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole has a molecular weight of 129.18 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoroethyl)-3-methyl-2,5-dihydropyrrole is sourced from PubChem (CID 88589108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).