About (E)-3-chlorohex-2-ene
(E)-3-chlorohex-2-ene (PubChem CID 88589144) has the molecular formula C6H11Cl
and a molecular weight of 118.61 g/mol. Its IUPAC name is (E)-3-chlorohex-2-ene.
Molecular Properties
| Compound Name | (E)-3-chlorohex-2-ene |
| PubChem CID | 88589144 |
| Molecular Formula | C6H11Cl |
| Molecular Weight | 118.61 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | (E)-3-chlorohex-2-ene |
| SMILES | C/C=C(/Cl)CCC |
| InChI | InChI=1S/C6H11Cl/c1-3-5-6(7)4-2/h4H,3,5H2,1-2H3/b6-4+ |
| InChIKey | HHSWIJBRZQKOOK-GQCTYLIASA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (E)-3-chlorohex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-chlorohex-2-ene?
The IUPAC name of (E)-3-chlorohex-2-ene (CID 88589144) is (E)-3-chlorohex-2-ene.
What is the SMILES notation for (E)-3-chlorohex-2-ene?
The canonical SMILES for (E)-3-chlorohex-2-ene is C/C=C(/Cl)CCC.
What is the InChIKey of (E)-3-chlorohex-2-ene?
The InChIKey is HHSWIJBRZQKOOK-GQCTYLIASA-N. The full InChI is InChI=1S/C6H11Cl/c1-3-5-6(7)4-2/h4H,3,5H2,1-2H3/b6-4+.
What are the key properties of (E)-3-chlorohex-2-ene?
(E)-3-chlorohex-2-ene has a molecular weight of 118.61 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-chlorohex-2-ene is sourced from PubChem (CID 88589144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).