C18H31N — CID 88589153
2-[(3E)-4,5-dimethylhexa-3,5-dien-2-yl]-5-ethyl-3,3,4,4-tetramethyl-2H-pyrrole (PubChem CID 88589153) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2-[(3E)-4,5-dimethylhexa-3,5-dien-2-yl]-5-ethyl-3,3,4,4-tetramethyl-2H-pyrrole.
| Compound Name | 2-[(3E)-4,5-dimethylhexa-3,5-dien-2-yl]-5-ethyl-3,3,4,4-tetramethyl-2H-pyrrole |
|---|---|
| PubChem CID | 88589153 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2-[(3E)-4,5-dimethylhexa-3,5-dien-2-yl]-5-ethyl-3,3,4,4-tetramethyl-2H-pyrrole |
| SMILES | C=C(C)/C(C)=C/C(C)C1N=C(CC)C(C)(C)C1(C)C |
| InChI | InChI=1S/C18H31N/c1-10-15-17(6,7)18(8,9)16(19-15)14(5)11-13(4)12(2)3/h11,14,16H,2,10H2,1,3-9H3/b13-11+ |
| InChIKey | IGYKVNPSNHHLAA-ACCUITESSA-N |
| XLogP | 5.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|