C62H113NO2 — CID 88589528
[(6Z,9Z,28Z,31Z)-19-[(8Z,11Z)-heptadeca-8,11-dienyl]heptatriaconta-6,9,28,31-tetraen-18-yl] 6-(dimethylamino)hexanoate (PubChem CID 88589528) has the molecular formula C62H113NO2 and a molecular weight of 904.59 g/mol. Its IUPAC name is [(6Z,9Z,28Z,31Z)-19-[(8Z,11Z)-heptadeca-8,11-dienyl]heptatriaconta-6,9,28,31-tetraen-18-yl] 6-(dimethylamino)hexanoate.
| Compound Name | [(6Z,9Z,28Z,31Z)-19-[(8Z,11Z)-heptadeca-8,11-dienyl]heptatriaconta-6,9,28,31-tetraen-18-yl] 6-(dimethylamino)hexanoate |
|---|---|
| PubChem CID | 88589528 |
| Molecular Formula | C62H113NO2 |
| Molecular Weight | 904.59 g/mol |
| Exact Mass | 903.88 |
| IUPAC Name | [(6Z,9Z,28Z,31Z)-19-[(8Z,11Z)-heptadeca-8,11-dienyl]heptatriaconta-6,9,28,31-tetraen-18-yl] 6-(dimethylamino)hexanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCC/C=C\C/C=C\CCCCC)C(CCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCCCCN(C)C |
| InChI | InChI=1S/C62H113NO2/c1-6-9-12-15-18-21-24-27-30-33-35-38-41-44-47-51-56-60(55-50-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2)61(65-62(64)58-53-49-54-59-63(4)5)57-52-48-45-42-39-36-32-29-26-23-20-17-14-11-8-3/h18-23,27-32,60-61H,6-17,24-26,33-59H2,1-5H3/b21-18-,22-19-,23-20-,30-27-,31-28-,32-29- |
| InChIKey | HDJFUILBBGEILK-CWJLHRMTSA-N |
| XLogP | 20.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.59 |
| LogP ≤ 5 | 20.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|