C63H117NO2 — CID 88589552
(6Z,9Z,31Z,34Z)-20-[2-(dimethylamino)ethyl]-19-methyl-21-[(9Z,12Z)-octadeca-9,12-dienyl]tetraconta-6,9,31,34-tetraene-19,21-diol (PubChem CID 88589552) has the molecular formula C63H117NO2 and a molecular weight of 920.63 g/mol. Its IUPAC name is (6Z,9Z,31Z,34Z)-20-[2-(dimethylamino)ethyl]-19-methyl-21-[(9Z,12Z)-octadeca-9,12-dienyl]tetraconta-6,9,31,34-tetraene-19,21-diol.
| Compound Name | (6Z,9Z,31Z,34Z)-20-[2-(dimethylamino)ethyl]-19-methyl-21-[(9Z,12Z)-octadeca-9,12-dienyl]tetraconta-6,9,31,34-tetraene-19,21-diol |
|---|---|
| PubChem CID | 88589552 |
| Molecular Formula | C63H117NO2 |
| Molecular Weight | 920.63 g/mol |
| Exact Mass | 919.91 |
| IUPAC Name | (6Z,9Z,31Z,34Z)-20-[2-(dimethylamino)ethyl]-19-methyl-21-[(9Z,12Z)-octadeca-9,12-dienyl]tetraconta-6,9,31,34-tetraene-19,21-diol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(O)(CCCCCCCC/C=C\C/C=C\CCCCC)C(CCN(C)C)C(C)(O)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C63H117NO2/c1-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-55-59-63(66,58-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-3)61(56-60-64(5)6)62(4,65)57-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-2/h19-24,28-33,61,65-66H,7-18,25-27,34-60H2,1-6H3/b22-19-,23-20-,24-21-,31-28-,32-29-,33-30- |
| InChIKey | XTAOOKSLHVXJPZ-MOKVCOEPSA-N |
| XLogP | 20.04 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.63 |
| LogP ≤ 5 | 20.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|