About N-butyl-6-ethenylocta-5,7-dien-1-imine
N-butyl-6-ethenylocta-5,7-dien-1-imine (PubChem CID 88589591) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is N-butyl-6-ethenylocta-5,7-dien-1-imine.
Molecular Properties
| Compound Name | N-butyl-6-ethenylocta-5,7-dien-1-imine |
| PubChem CID | 88589591 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-butyl-6-ethenylocta-5,7-dien-1-imine |
| SMILES | C=CC(C=C)=CCCC/C=N/CCCC |
| InChI | InChI=1S/C14H23N/c1-4-7-12-15-13-10-8-9-11-14(5-2)6-3/h5-6,11,13H,2-4,7-10,12H2,1H3/b15-13+ |
| InChIKey | HBQHBDCQAHKTPQ-FYWRMAATSA-N |
| XLogP | 4.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6-ethenylocta-5,7-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6-ethenylocta-5,7-dien-1-imine?
The IUPAC name of N-butyl-6-ethenylocta-5,7-dien-1-imine (CID 88589591) is N-butyl-6-ethenylocta-5,7-dien-1-imine.
What is the SMILES notation for N-butyl-6-ethenylocta-5,7-dien-1-imine?
The canonical SMILES for N-butyl-6-ethenylocta-5,7-dien-1-imine is C=CC(C=C)=CCCC/C=N/CCCC.
What is the InChIKey of N-butyl-6-ethenylocta-5,7-dien-1-imine?
The InChIKey is HBQHBDCQAHKTPQ-FYWRMAATSA-N. The full InChI is InChI=1S/C14H23N/c1-4-7-12-15-13-10-8-9-11-14(5-2)6-3/h5-6,11,13H,2-4,7-10,12H2,1H3/b15-13+.
What are the key properties of N-butyl-6-ethenylocta-5,7-dien-1-imine?
N-butyl-6-ethenylocta-5,7-dien-1-imine has a molecular weight of 205.34 g/mol, XLogP of 4.33, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6-ethenylocta-5,7-dien-1-imine is sourced from PubChem (CID 88589591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).