About 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+))
2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+)) (PubChem CID 88589676) has the molecular formula C7H7NRb2
and a molecular weight of 276.08 g/mol. Its IUPAC name is 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+)).
Molecular Properties
| Compound Name | 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+)) |
| PubChem CID | 88589676 |
| Molecular Formula | C7H7NRb2 |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.88 |
| IUPAC Name | 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+)) |
| SMILES | Cc1[c-]c[c-]c(C)n1.[Rb+].[Rb+] |
| InChI | InChI=1S/C7H7N.2Rb/c1-6-4-3-5-7(2)8-6;;/h3H,1-2H3;;/q-2;2*+1 |
| InChIKey | ARVNUWPWBYEAOW-UHFFFAOYSA-N |
| XLogP | -4.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+))?
The IUPAC name of 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+)) (CID 88589676) is 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+)).
What is the SMILES notation for 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+))?
The canonical SMILES for 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+)) is Cc1[c-]c[c-]c(C)n1.[Rb+].[Rb+].
What is the InChIKey of 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+))?
The InChIKey is ARVNUWPWBYEAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N.2Rb/c1-6-4-3-5-7(2)8-6;;/h3H,1-2H3;;/q-2;2*+1.
What are the key properties of 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+))?
2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+)) has a molecular weight of 276.08 g/mol, XLogP of -4.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-3,5-dihydropyridine-3,5-diide;bis(rubidium(1+)) is sourced from PubChem (CID 88589676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).