About 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+)
2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+) (PubChem CID 88589677) has the molecular formula C7H8NRb
and a molecular weight of 191.62 g/mol. Its IUPAC name is 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+).
Molecular Properties
| Compound Name | 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+) |
| PubChem CID | 88589677 |
| Molecular Formula | C7H8NRb |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 190.98 |
| IUPAC Name | 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+) |
| SMILES | Cc1[c-]ccc(C)n1.[Rb+] |
| InChI | InChI=1S/C7H8N.Rb/c1-6-4-3-5-7(2)8-6;/h3-4H,1-2H3;/q-1;+1 |
| InChIKey | HQOWPXCDYXUZAF-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+)?
The IUPAC name of 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+) (CID 88589677) is 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+).
What is the SMILES notation for 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+)?
The canonical SMILES for 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+) is Cc1[c-]ccc(C)n1.[Rb+].
What is the InChIKey of 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+)?
The InChIKey is HQOWPXCDYXUZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N.Rb/c1-6-4-3-5-7(2)8-6;/h3-4H,1-2H3;/q-1;+1.
What are the key properties of 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+)?
2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+) has a molecular weight of 191.62 g/mol, XLogP of -1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-3H-pyridin-3-ide;rubidium(1+) is sourced from PubChem (CID 88589677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).