C11H15ClFN3O — CID 88589837
3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexan-1-ol (PubChem CID 88589837) has the molecular formula C11H15ClFN3O and a molecular weight of 259.71 g/mol. Its IUPAC name is 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexan-1-ol.
| Compound Name | 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 88589837 |
| Molecular Formula | C11H15ClFN3O |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCCC(Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C11H15ClFN3O/c1-11(17)4-2-3-7(5-11)15-9-8(13)6-14-10(12)16-9/h6-7,17H,2-5H2,1H3,(H,14,15,16) |
| InChIKey | FLSASPJMVTXEMW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |