About cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol
cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol (PubChem CID 88589933) has the molecular formula C11H15ClFN3O2
and a molecular weight of 275.71 g/mol. Its IUPAC name is cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol |
| PubChem CID | 88589933 |
| Molecular Formula | C11H15ClFN3O2 |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol |
| SMILES | CO[C@@H]1CCC[C@H](Nc2nc(Cl)ncc2F)C1O |
| InChI | InChI=1S/C11H15ClFN3O2/c1-18-8-4-2-3-7(9(8)17)15-10-6(13)5-14-11(12)16-10/h5,7-9,17H,2-4H2,1H3,(H,14,15,16)/t7-,8+,9?/m0/s1 |
| InChIKey | QJPBZKJGEAGYSE-ZQTLJVIJSA-N |
| XLogP | 1.61 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol?
The IUPAC name of cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol (CID 88589933) is cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol.
What is the SMILES notation for cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol?
The canonical SMILES for cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol is CO[C@@H]1CCC[C@H](Nc2nc(Cl)ncc2F)C1O.
What is the InChIKey of cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol?
The InChIKey is QJPBZKJGEAGYSE-ZQTLJVIJSA-N. The full InChI is InChI=1S/C11H15ClFN3O2/c1-18-8-4-2-3-7(9(8)17)15-10-6(13)5-14-11(12)16-10/h5,7-9,17H,2-4H2,1H3,(H,14,15,16)/t7-,8+,9?/m0/s1.
What are the key properties of cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol?
cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol has a molecular weight of 275.71 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,6R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-6-methoxycyclohexan-1-ol is sourced from PubChem (CID 88589933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).