C26H26N10O3 — CID 88589977
2-[[6-(butan-2-ylamino)-5-cyano-2-(2-hydroxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-1-(4-nitrophenyl)pyrrole-3,4-dicarbonitrile (PubChem CID 88589977) has the molecular formula C26H26N10O3 and a molecular weight of 526.56 g/mol. Its IUPAC name is 2-[[6-(butan-2-ylamino)-5-cyano-2-(2-hydroxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-1-(4-nitrophenyl)pyrrole-3,4-dicarbonitrile.
| Compound Name | 2-[[6-(butan-2-ylamino)-5-cyano-2-(2-hydroxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-1-(4-nitrophenyl)pyrrole-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 88589977 |
| Molecular Formula | C26H26N10O3 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2-[[6-(butan-2-ylamino)-5-cyano-2-(2-hydroxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-1-(4-nitrophenyl)pyrrole-3,4-dicarbonitrile |
| SMILES | CCC(C)Nc1nc(NCC(C)O)c(/N=N/c2c(C#N)c(C#N)cn2-c2ccc([N+](=O)[O-])cc2)c(C)c1C#N |
| InChI | InChI=1S/C26H26N10O3/c1-5-15(2)31-24-21(11-28)17(4)23(25(32-24)30-13-16(3)37)33-34-26-22(12-29)18(10-27)14-35(26)19-6-8-20(9-7-19)36(38)39/h6-9,14-16,37H,5,13H2,1-4H3,(H2,30,31,32)/b34-33+ |
| InChIKey | BDAVEOIUSISMHO-JEIPZWNWSA-N |
| XLogP | 5.12 |
| TPSA | 201.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|