About (2,3,5,6-tetramethylphenyl) hypoiodite
(2,3,5,6-tetramethylphenyl) hypoiodite (PubChem CID 88590021) has the molecular formula C10H13IO
and a molecular weight of 276.12 g/mol. Its IUPAC name is (2,3,5,6-tetramethylphenyl) hypoiodite.
Molecular Properties
| Compound Name | (2,3,5,6-tetramethylphenyl) hypoiodite |
| PubChem CID | 88590021 |
| Molecular Formula | C10H13IO |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | (2,3,5,6-tetramethylphenyl) hypoiodite |
| SMILES | Cc1cc(C)c(C)c(OI)c1C |
| InChI | InChI=1S/C10H13IO/c1-6-5-7(2)9(4)10(12-11)8(6)3/h5H,1-4H3 |
| InChIKey | KLDOXHJEARMCCF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2,3,5,6-tetramethylphenyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,5,6-tetramethylphenyl) hypoiodite?
The IUPAC name of (2,3,5,6-tetramethylphenyl) hypoiodite (CID 88590021) is (2,3,5,6-tetramethylphenyl) hypoiodite.
What is the SMILES notation for (2,3,5,6-tetramethylphenyl) hypoiodite?
The canonical SMILES for (2,3,5,6-tetramethylphenyl) hypoiodite is Cc1cc(C)c(C)c(OI)c1C.
What is the InChIKey of (2,3,5,6-tetramethylphenyl) hypoiodite?
The InChIKey is KLDOXHJEARMCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13IO/c1-6-5-7(2)9(4)10(12-11)8(6)3/h5H,1-4H3.
What are the key properties of (2,3,5,6-tetramethylphenyl) hypoiodite?
(2,3,5,6-tetramethylphenyl) hypoiodite has a molecular weight of 276.12 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,5,6-tetramethylphenyl) hypoiodite is sourced from PubChem (CID 88590021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).