C18H20FN5S — CID 88590113
4-N-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]sulfanyl-3-fluorophenyl]-2-N,6-dimethylpyrimidine-2,4-diamine (PubChem CID 88590113) has the molecular formula C18H20FN5S and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-N-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]sulfanyl-3-fluorophenyl]-2-N,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]sulfanyl-3-fluorophenyl]-2-N,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 88590113 |
| Molecular Formula | C18H20FN5S |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-N-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]sulfanyl-3-fluorophenyl]-2-N,6-dimethylpyrimidine-2,4-diamine |
| SMILES | C=C/C=C(\C=C/N)Sc1ccc(Nc2cc(C)nc(NC)n2)cc1F |
| InChI | InChI=1S/C18H20FN5S/c1-4-5-14(8-9-20)25-16-7-6-13(11-15(16)19)23-17-10-12(2)22-18(21-3)24-17/h4-11H,1,20H2,2-3H3,(H2,21,22,23,24)/b9-8-,14-5+ |
| InChIKey | SMONMVJFKCASHE-KBZALZPKSA-N |
| XLogP | 4.34 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|