C19H23FN6S — CID 88590148
6-N-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]sulfanyl-3-fluorophenyl]-4-N-propan-2-ylpyrimidine-2,4,6-triamine (PubChem CID 88590148) has the molecular formula C19H23FN6S and a molecular weight of 386.50 g/mol. Its IUPAC name is 6-N-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]sulfanyl-3-fluorophenyl]-4-N-propan-2-ylpyrimidine-2,4,6-triamine.
| Compound Name | 6-N-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]sulfanyl-3-fluorophenyl]-4-N-propan-2-ylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 88590148 |
| Molecular Formula | C19H23FN6S |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 6-N-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]sulfanyl-3-fluorophenyl]-4-N-propan-2-ylpyrimidine-2,4,6-triamine |
| SMILES | C=C/C=C(\C=C/N)Sc1ccc(Nc2cc(NC(C)C)nc(N)n2)cc1F |
| InChI | InChI=1S/C19H23FN6S/c1-4-5-14(8-9-21)27-16-7-6-13(10-15(16)20)24-18-11-17(23-12(2)3)25-19(22)26-18/h4-12H,1,21H2,2-3H3,(H4,22,23,24,25,26)/b9-8-,14-5+ |
| InChIKey | HEAYLILASXNPBQ-KBZALZPKSA-N |
| XLogP | 4.40 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|