About 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium
3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium (PubChem CID 88590160) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium.
Molecular Properties
| Compound Name | 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium |
| PubChem CID | 88590160 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium |
| SMILES | CC1=[N+]([O-])CC(C)C=C1 |
| InChI | InChI=1S/C7H11NO/c1-6-3-4-7(2)8(9)5-6/h3-4,6H,5H2,1-2H3 |
| InChIKey | CVFAPXJPYIUKOJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium?
The IUPAC name of 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium (CID 88590160) is 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium.
What is the SMILES notation for 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium?
The canonical SMILES for 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium is CC1=[N+]([O-])CC(C)C=C1.
What is the InChIKey of 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium?
The InChIKey is CVFAPXJPYIUKOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-6-3-4-7(2)8(9)5-6/h3-4,6H,5H2,1-2H3.
What are the key properties of 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium?
3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium has a molecular weight of 125.17 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-1-oxido-2,3-dihydropyridin-1-ium is sourced from PubChem (CID 88590160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).