C10H10F11I — CID 88590921
1,1,1,2,5,6,6,6-octafluoro-3-(2-iodoethyl)-5-methyl-2-(trifluoromethyl)hexane (PubChem CID 88590921) has the molecular formula C10H10F11I and a molecular weight of 466.07 g/mol. Its IUPAC name is 1,1,1,2,5,6,6,6-octafluoro-3-(2-iodoethyl)-5-methyl-2-(trifluoromethyl)hexane.
| Compound Name | 1,1,1,2,5,6,6,6-octafluoro-3-(2-iodoethyl)-5-methyl-2-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 88590921 |
| Molecular Formula | C10H10F11I |
| Molecular Weight | 466.07 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 1,1,1,2,5,6,6,6-octafluoro-3-(2-iodoethyl)-5-methyl-2-(trifluoromethyl)hexane |
| SMILES | CC(F)(CC(CCI)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F11I/c1-6(11,8(13,14)15)4-5(2-3-22)7(12,9(16,17)18)10(19,20)21/h5H,2-4H2,1H3 |
| InChIKey | VQIYFYGYPRSRDV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.07 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|