C10H9F12I — CID 88590923
4-(2,2-difluoro-2-iodoethyl)-1,1,1,2,6,6,6-heptafluoro-2-methyl-5-(trifluoromethyl)hexane (PubChem CID 88590923) has the molecular formula C10H9F12I and a molecular weight of 484.06 g/mol. Its IUPAC name is 4-(2,2-difluoro-2-iodoethyl)-1,1,1,2,6,6,6-heptafluoro-2-methyl-5-(trifluoromethyl)hexane.
| Compound Name | 4-(2,2-difluoro-2-iodoethyl)-1,1,1,2,6,6,6-heptafluoro-2-methyl-5-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 88590923 |
| Molecular Formula | C10H9F12I |
| Molecular Weight | 484.06 g/mol |
| Exact Mass | 483.96 |
| IUPAC Name | 4-(2,2-difluoro-2-iodoethyl)-1,1,1,2,6,6,6-heptafluoro-2-methyl-5-(trifluoromethyl)hexane |
| SMILES | CC(F)(CC(CC(F)(F)I)C(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F12I/c1-6(11,10(20,21)22)2-4(3-7(12,13)23)5(8(14,15)16)9(17,18)19/h4-5H,2-3H2,1H3 |
| InChIKey | OLWMMGJCARKCAY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.06 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|