C10H8F13I — CID 88590924
3-(2,2-difluoro-2-iodoethyl)-1,1,1,2,5,6,6,6-octafluoro-5-methyl-2-(trifluoromethyl)hexane (PubChem CID 88590924) has the molecular formula C10H8F13I and a molecular weight of 502.05 g/mol. Its IUPAC name is 3-(2,2-difluoro-2-iodoethyl)-1,1,1,2,5,6,6,6-octafluoro-5-methyl-2-(trifluoromethyl)hexane.
| Compound Name | 3-(2,2-difluoro-2-iodoethyl)-1,1,1,2,5,6,6,6-octafluoro-5-methyl-2-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 88590924 |
| Molecular Formula | C10H8F13I |
| Molecular Weight | 502.05 g/mol |
| Exact Mass | 501.95 |
| IUPAC Name | 3-(2,2-difluoro-2-iodoethyl)-1,1,1,2,5,6,6,6-octafluoro-5-methyl-2-(trifluoromethyl)hexane |
| SMILES | CC(F)(CC(CC(F)(F)I)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F13I/c1-5(11,8(15,16)17)2-4(3-6(12,13)24)7(14,9(18,19)20)10(21,22)23/h4H,2-3H2,1H3 |
| InChIKey | AEVCYQNRFOZTHC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.05 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|