C11H10F12 — CID 88590950
1,1,1,2,6,7,7,7-octafluoro-4-(1-fluoroethenyl)-2-methyl-6-(trifluoromethyl)heptane (PubChem CID 88590950) has the molecular formula C11H10F12 and a molecular weight of 370.18 g/mol. Its IUPAC name is 1,1,1,2,6,7,7,7-octafluoro-4-(1-fluoroethenyl)-2-methyl-6-(trifluoromethyl)heptane.
| Compound Name | 1,1,1,2,6,7,7,7-octafluoro-4-(1-fluoroethenyl)-2-methyl-6-(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 88590950 |
| Molecular Formula | C11H10F12 |
| Molecular Weight | 370.18 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 1,1,1,2,6,7,7,7-octafluoro-4-(1-fluoroethenyl)-2-methyl-6-(trifluoromethyl)heptane |
| SMILES | C=C(F)C(CC(C)(F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F12/c1-5(12)6(3-7(2,13)9(15,16)17)4-8(14,10(18,19)20)11(21,22)23/h6H,1,3-4H2,2H3 |
| InChIKey | RBMGGZOCJPXXEP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.18 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |