C12H10F14 — CID 88590967
(E)-6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)hept-2-ene (PubChem CID 88590967) has the molecular formula C12H10F14 and a molecular weight of 420.18 g/mol. Its IUPAC name is (E)-6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)hept-2-ene.
| Compound Name | (E)-6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)hept-2-ene |
|---|---|
| PubChem CID | 88590967 |
| Molecular Formula | C12H10F14 |
| Molecular Weight | 420.18 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | (E)-6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)hept-2-ene |
| SMILES | C/C=C/C(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F14/c1-2-3-6(4-7(13,9(15,16)17)10(18,19)20)5-8(14,11(21,22)23)12(24,25)26/h2-3,6H,4-5H2,1H3/b3-2+ |
| InChIKey | HCAXZCYQIYDDNB-NSCUHMNNSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.18 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|