C25H12F4N4O — CID 88591796
2,7-bis(2,4-difluorophenyl)-3-(4-isocyanophenyl)-8H-imidazo[1,2-a]pyrimidin-5-one (PubChem CID 88591796) has the molecular formula C25H12F4N4O and a molecular weight of 460.39 g/mol. Its IUPAC name is 2,7-bis(2,4-difluorophenyl)-3-(4-isocyanophenyl)-8H-imidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 2,7-bis(2,4-difluorophenyl)-3-(4-isocyanophenyl)-8H-imidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 88591796 |
| Molecular Formula | C25H12F4N4O |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2,7-bis(2,4-difluorophenyl)-3-(4-isocyanophenyl)-8H-imidazo[1,2-a]pyrimidin-5-one |
| SMILES | [C-]#[N+]c1ccc(-c2c(-c3ccc(F)cc3F)nc3[nH]c(-c4ccc(F)cc4F)cc(=O)n23)cc1 |
| InChI | InChI=1S/C25H12F4N4O/c1-30-16-6-2-13(3-7-16)24-23(18-9-5-15(27)11-20(18)29)32-25-31-21(12-22(34)33(24)25)17-8-4-14(26)10-19(17)28/h2-12H,(H,31,32) |
| InChIKey | GQBHDROKIACHAX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|