About 1-chloro-4-fluorobenzene;isocyanic acid
1-chloro-4-fluorobenzene;isocyanic acid (PubChem CID 88592426) has the molecular formula C8H6ClFN2O2
and a molecular weight of 216.60 g/mol. Its IUPAC name is 1-chloro-4-fluorobenzene;isocyanic acid.
Molecular Properties
| Compound Name | 1-chloro-4-fluorobenzene;isocyanic acid |
| PubChem CID | 88592426 |
| Molecular Formula | C8H6ClFN2O2 |
| Molecular Weight | 216.60 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 1-chloro-4-fluorobenzene;isocyanic acid |
| SMILES | Fc1ccc(Cl)cc1.N=C=O.N=C=O |
| InChI | InChI=1S/C6H4ClF.2CHNO/c7-5-1-3-6(8)4-2-5;2*2-1-3/h1-4H;2*2H |
| InChIKey | FALGBHZWHOOCAH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.60 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-fluorobenzene;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-fluorobenzene;isocyanic acid?
The IUPAC name of 1-chloro-4-fluorobenzene;isocyanic acid (CID 88592426) is 1-chloro-4-fluorobenzene;isocyanic acid.
What is the SMILES notation for 1-chloro-4-fluorobenzene;isocyanic acid?
The canonical SMILES for 1-chloro-4-fluorobenzene;isocyanic acid is Fc1ccc(Cl)cc1.N=C=O.N=C=O.
What is the InChIKey of 1-chloro-4-fluorobenzene;isocyanic acid?
The InChIKey is FALGBHZWHOOCAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClF.2CHNO/c7-5-1-3-6(8)4-2-5;2*2-1-3/h1-4H;2*2H.
What are the key properties of 1-chloro-4-fluorobenzene;isocyanic acid?
1-chloro-4-fluorobenzene;isocyanic acid has a molecular weight of 216.60 g/mol, XLogP of 2.28, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-fluorobenzene;isocyanic acid is sourced from PubChem (CID 88592426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).