C28H44N2O5 — CID 88592431
(2S)-6-amino-2-(carboxymethylamino)hexanoic acid;3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal (PubChem CID 88592431) has the molecular formula C28H44N2O5 and a molecular weight of 488.67 g/mol. Its IUPAC name is (2S)-6-amino-2-(carboxymethylamino)hexanoic acid;3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal.
| Compound Name | (2S)-6-amino-2-(carboxymethylamino)hexanoic acid;3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 88592431 |
| Molecular Formula | C28H44N2O5 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | (2S)-6-amino-2-(carboxymethylamino)hexanoic acid;3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)CCCC1(C)C)=CC=O.NCCCC[C@H](NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H28O.C8H16N2O4/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5;9-4-2-1-3-6(8(13)14)10-5-7(11)12/h6,8-9,11-13,15H,7,10,14H2,1-5H3;6,10H,1-5,9H2,(H,11,12)(H,13,14)/t;6-/m.0/s1 |
| InChIKey | ZIEYPPNFFOPPRW-ZCMDIHMWSA-N |
| XLogP | 4.96 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|