C65H50Br2N6 — CID 88592452
9-[4-[4,6-bis[4-(3-bromocarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3,6-ditert-butylcarbazole (PubChem CID 88592452) has the molecular formula C65H50Br2N6 and a molecular weight of 1074.96 g/mol. Its IUPAC name is 9-[4-[4,6-bis[4-(3-bromocarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3,6-ditert-butylcarbazole.
| Compound Name | 9-[4-[4,6-bis[4-(3-bromocarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3,6-ditert-butylcarbazole |
|---|---|
| PubChem CID | 88592452 |
| Molecular Formula | C65H50Br2N6 |
| Molecular Weight | 1074.96 g/mol |
| Exact Mass | 1072.25 |
| IUPAC Name | 9-[4-[4,6-bis[4-(3-bromocarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3,6-ditert-butylcarbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(-c2nc(-c3ccc(-n4c5ccccc5c5cc(Br)ccc54)cc3)nc(-c3ccc(-n4c5ccccc5c5cc(Br)ccc54)cc3)n2)cc1 |
| InChI | InChI=1S/C65H50Br2N6/c1-64(2,3)42-21-31-57-51(35-42)52-36-43(65(4,5)6)22-32-58(52)73(57)48-29-19-41(20-30-48)63-69-61(39-15-25-46(26-16-39)71-55-13-9-7-11-49(55)53-37-44(66)23-33-59(53)71)68-62(70-63)40-17-27-47(28-18-40)72-56-14-10-8-12-50(56)54-38-45(67)24-34-60(54)72/h7-38H,1-6H3 |
| InChIKey | URRYWDXJINOXTH-UHFFFAOYSA-N |
| XLogP | 18.28 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1074.96 |
| LogP ≤ 5 | 18.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |