About [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane
[3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 88592546) has the molecular formula C21H18F6Si
and a molecular weight of 412.45 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane.
Molecular Properties
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane |
| PubChem CID | 88592546 |
| Molecular Formula | C21H18F6Si |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | C[Si](C)(C1=C(c2ccccc2)C=CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F6Si/c1-28(2,19-10-6-9-18(19)14-7-4-3-5-8-14)17-12-15(20(22,23)24)11-16(13-17)21(25,26)27/h3-9,11-13H,10H2,1-2H3 |
| InChIKey | RTNXUULVGJPZEQ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane?
The IUPAC name of [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane (CID 88592546) is [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane.
What is the SMILES notation for [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane?
The canonical SMILES for [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane is C[Si](C)(C1=C(c2ccccc2)C=CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane?
The InChIKey is RTNXUULVGJPZEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F6Si/c1-28(2,19-10-6-9-18(19)14-7-4-3-5-8-14)17-12-15(20(22,23)24)11-16(13-17)21(25,26)27/h3-9,11-13H,10H2,1-2H3.
What are the key properties of [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane?
[3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane has a molecular weight of 412.45 g/mol, XLogP of 6.59, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)phenyl]-dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silane is sourced from PubChem (CID 88592546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).