C55H71Cl3SiTi — CID 88592905
trichlorotitanium(1+);tris(3,5-ditert-butylphenyl)-(1,9-dihydrofluoren-1-id-9-yl)silane (PubChem CID 88592905) has the molecular formula C55H71Cl3SiTi and a molecular weight of 914.48 g/mol. Its IUPAC name is trichlorotitanium(1+);tris(3,5-ditert-butylphenyl)-(1,9-dihydrofluoren-1-id-9-yl)silane.
| Compound Name | trichlorotitanium(1+);tris(3,5-ditert-butylphenyl)-(1,9-dihydrofluoren-1-id-9-yl)silane |
|---|---|
| PubChem CID | 88592905 |
| Molecular Formula | C55H71Cl3SiTi |
| Molecular Weight | 914.48 g/mol |
| Exact Mass | 912.39 |
| IUPAC Name | trichlorotitanium(1+);tris(3,5-ditert-butylphenyl)-(1,9-dihydrofluoren-1-id-9-yl)silane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc([Si](c2cc(C(C)(C)C)cc(C(C)(C)C)c2)(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C2c3[c-]cccc3-c3ccccc32)c1.Cl[Ti+](Cl)Cl |
| InChI | InChI=1S/C55H71Si.3ClH.Ti/c1-50(2,3)36-27-37(51(4,5)6)31-42(30-36)56(43-32-38(52(7,8)9)28-39(33-43)53(10,11)12,44-34-40(54(13,14)15)29-41(35-44)55(16,17)18)49-47-25-21-19-23-45(47)46-24-20-22-26-48(46)49;;;;/h19-25,27-35,49H,1-18H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | FLOYAQCWBLZUMM-UHFFFAOYSA-K |
| XLogP | 15.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.48 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|