About 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol
7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol (PubChem CID 88593438) has the molecular formula C21H14F6O
and a molecular weight of 396.33 g/mol. Its IUPAC name is 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol.
Molecular Properties
| Compound Name | 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol |
| PubChem CID | 88593438 |
| Molecular Formula | C21H14F6O |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol |
| SMILES | CC1(C)c2ccc(C(F)(F)F)cc2-c2c1cc(O)c1ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C21H14F6O/c1-19(2)15-6-4-11(21(25,26)27)8-14(15)18-13-7-10(20(22,23)24)3-5-12(13)17(28)9-16(18)19/h3-9,28H,1-2H3 |
| InChIKey | ICMFKKJXPSZHGN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol?
The IUPAC name of 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol (CID 88593438) is 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol.
What is the SMILES notation for 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol?
The canonical SMILES for 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol is CC1(C)c2ccc(C(F)(F)F)cc2-c2c1cc(O)c1ccc(C(F)(F)F)cc21.
What is the InChIKey of 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol?
The InChIKey is ICMFKKJXPSZHGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F6O/c1-19(2)15-6-4-11(21(25,26)27)8-14(15)18-13-7-10(20(22,23)24)3-5-12(13)17(28)9-16(18)19/h3-9,28H,1-2H3.
What are the key properties of 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol?
7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol has a molecular weight of 396.33 g/mol, XLogP of 6.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-2,10-bis(trifluoromethyl)benzo[c]fluoren-5-ol is sourced from PubChem (CID 88593438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).