C13H21OTi- — CID 88593550
1,2,3,5,5-pentamethylcyclopenta-1,3-diene;propan-2-one;titanium (PubChem CID 88593550) has the molecular formula C13H21OTi- and a molecular weight of 241.18 g/mol. Its IUPAC name is 1,2,3,5,5-pentamethylcyclopenta-1,3-diene;propan-2-one;titanium.
| Compound Name | 1,2,3,5,5-pentamethylcyclopenta-1,3-diene;propan-2-one;titanium |
|---|---|
| PubChem CID | 88593550 |
| Molecular Formula | C13H21OTi- |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1,2,3,5,5-pentamethylcyclopenta-1,3-diene;propan-2-one;titanium |
| SMILES | CC(C)=O.CC1=[C-]C(C)(C)C(C)=C1C.[Ti] |
| InChI | InChI=1S/C10H15.C3H6O.Ti/c1-7-6-10(4,5)9(3)8(7)2;1-3(2)4;/h1-5H3;1-2H3;/q-1;; |
| InChIKey | VQSHRMAIUIGJCO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|