C6H2F10O — CID 88593864
2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-(trifluoromethyl)oxirane (PubChem CID 88593864) has the molecular formula C6H2F10O and a molecular weight of 280.06 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-(trifluoromethyl)oxirane.
| Compound Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 88593864 |
| Molecular Formula | C6H2F10O |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-(trifluoromethyl)oxirane |
| SMILES | FC(F)(F)C1OC1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H2F10O/c7-3(5(11,12)13,6(14,15)16)1-2(17-1)4(8,9)10/h1-2H |
| InChIKey | HDBGQROWDAYSNL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|