About tetracen-5-amine
tetracen-5-amine (PubChem CID 88593901) has the molecular formula C18H13N
and a molecular weight of 243.31 g/mol. Its IUPAC name is tetracen-5-amine.
Molecular Properties
| Compound Name | tetracen-5-amine |
| PubChem CID | 88593901 |
| Molecular Formula | C18H13N |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | tetracen-5-amine |
| SMILES | Nc1c2ccccc2cc2cc3ccccc3cc12 |
| InChI | InChI=1S/C18H13N/c19-18-16-8-4-3-7-14(16)10-15-9-12-5-1-2-6-13(12)11-17(15)18/h1-11H,19H2 |
| InChIKey | QSYLRPIYKMLAEI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze tetracen-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracen-5-amine?
The IUPAC name of tetracen-5-amine (CID 88593901) is tetracen-5-amine.
What is the SMILES notation for tetracen-5-amine?
The canonical SMILES for tetracen-5-amine is Nc1c2ccccc2cc2cc3ccccc3cc12.
What is the InChIKey of tetracen-5-amine?
The InChIKey is QSYLRPIYKMLAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N/c19-18-16-8-4-3-7-14(16)10-15-9-12-5-1-2-6-13(12)11-17(15)18/h1-11H,19H2.
What are the key properties of tetracen-5-amine?
tetracen-5-amine has a molecular weight of 243.31 g/mol, XLogP of 4.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetracen-5-amine is sourced from PubChem (CID 88593901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).