C10H12BrFN4O2S — CID 88594129
(5R)-5-(6-bromo-3-fluoro-2-pyridinyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 88594129) has the molecular formula C10H12BrFN4O2S and a molecular weight of 351.20 g/mol. Its IUPAC name is (5R)-5-(6-bromo-3-fluoro-2-pyridinyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-(6-bromo-3-fluoro-2-pyridinyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 88594129 |
| Molecular Formula | C10H12BrFN4O2S |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | (5R)-5-(6-bromo-3-fluoro-2-pyridinyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2nc(Br)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C10H12BrFN4O2S/c1-10(8-6(12)3-4-7(11)14-8)5-19(17,18)16(2)9(13)15-10/h3-4H,5H2,1-2H3,(H2,13,15)/t10-/m0/s1 |
| InChIKey | PRCCLLOFFCXGKV-JTQLQIEISA-N |
| XLogP | 0.79 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|