C21H22F3N5O4S — CID 88594215
N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4,5-trifluorophenyl]-5-(cyclopropylmethoxy)pyridine-2-carboxamide (PubChem CID 88594215) has the molecular formula C21H22F3N5O4S and a molecular weight of 497.50 g/mol. Its IUPAC name is N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4,5-trifluorophenyl]-5-(cyclopropylmethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4,5-trifluorophenyl]-5-(cyclopropylmethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 88594215 |
| Molecular Formula | C21H22F3N5O4S |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4,5-trifluorophenyl]-5-(cyclopropylmethoxy)pyridine-2-carboxamide |
| SMILES | CN1C(N)=N[C@](C)(c2c(F)c(F)cc(NC(=O)c3ccc(OCC4CC4)cn3)c2F)CS1(=O)=O |
| InChI | InChI=1S/C21H22F3N5O4S/c1-21(10-34(31,32)29(2)20(25)28-21)16-17(23)13(22)7-15(18(16)24)27-19(30)14-6-5-12(8-26-14)33-9-11-3-4-11/h5-8,11H,3-4,9-10H2,1-2H3,(H2,25,28)(H,27,30)/t21-/m0/s1 |
| InChIKey | NGAJLRMAVVRPJR-NRFANRHFSA-N |
| XLogP | 2.35 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|