C25H32O4S — CID 88594557
S-[(2R,4R,6R,7R,9R,14S)-6-hydroxy-9-methoxy-2,4-dimethyl-3-oxo-4-tetracyclo[5.4.4.01,8.07,14]pentadecanyl] benzenecarbothioate (PubChem CID 88594557) has the molecular formula C25H32O4S and a molecular weight of 428.59 g/mol. Its IUPAC name is S-[(2R,4R,6R,7R,9R,14S)-6-hydroxy-9-methoxy-2,4-dimethyl-3-oxo-4-tetracyclo[5.4.4.01,8.07,14]pentadecanyl] benzenecarbothioate.
| Compound Name | S-[(2R,4R,6R,7R,9R,14S)-6-hydroxy-9-methoxy-2,4-dimethyl-3-oxo-4-tetracyclo[5.4.4.01,8.07,14]pentadecanyl] benzenecarbothioate |
|---|---|
| PubChem CID | 88594557 |
| Molecular Formula | C25H32O4S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | S-[(2R,4R,6R,7R,9R,14S)-6-hydroxy-9-methoxy-2,4-dimethyl-3-oxo-4-tetracyclo[5.4.4.01,8.07,14]pentadecanyl] benzenecarbothioate |
| SMILES | COC1CCC23CC[C@H]4C[C@@]4(C12)[C@H](O)C[C@@](C)(SC(=O)c1ccccc1)C(=O)[C@@H]3C |
| InChI | InChI=1S/C25H32O4S/c1-15-21(27)23(2,30-22(28)16-7-5-4-6-8-16)14-19(26)25-13-17(25)9-11-24(15)12-10-18(29-3)20(24)25/h4-8,15,17-20,26H,9-14H2,1-3H3/t15-,17-,18?,19+,20?,23+,24?,25-/m0/s1 |
| InChIKey | WMQSRCNSNODGNJ-OBFOLCRTSA-N |
| XLogP | 4.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|