C17H19IO5 — CID 88594696
[(2E,6E)-3,7-dimethyl-8-oxoocta-2,6-dienyl] 2-(3-iodo-6-oxopyran-2-yl)acetate (PubChem CID 88594696) has the molecular formula C17H19IO5 and a molecular weight of 430.24 g/mol. Its IUPAC name is [(2E,6E)-3,7-dimethyl-8-oxoocta-2,6-dienyl] 2-(3-iodo-6-oxopyran-2-yl)acetate.
| Compound Name | [(2E,6E)-3,7-dimethyl-8-oxoocta-2,6-dienyl] 2-(3-iodo-6-oxopyran-2-yl)acetate |
|---|---|
| PubChem CID | 88594696 |
| Molecular Formula | C17H19IO5 |
| Molecular Weight | 430.24 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | [(2E,6E)-3,7-dimethyl-8-oxoocta-2,6-dienyl] 2-(3-iodo-6-oxopyran-2-yl)acetate |
| SMILES | C/C(C=O)=C\CC/C(C)=C/COC(=O)Cc1oc(=O)ccc1I |
| InChI | InChI=1S/C17H19IO5/c1-12(4-3-5-13(2)11-19)8-9-22-17(21)10-15-14(18)6-7-16(20)23-15/h5-8,11H,3-4,9-10H2,1-2H3/b12-8+,13-5+ |
| InChIKey | ODQCNYDCGSFTEJ-NVKJMBTPSA-N |
| XLogP | 3.20 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|