C8H6Cl6O — CID 88595437
chloroethane;2,3,4,5,6-pentachlorophenol (PubChem CID 88595437) has the molecular formula C8H6Cl6O and a molecular weight of 330.85 g/mol. Its IUPAC name is chloroethane;2,3,4,5,6-pentachlorophenol.
| Compound Name | chloroethane;2,3,4,5,6-pentachlorophenol |
|---|---|
| PubChem CID | 88595437 |
| Molecular Formula | C8H6Cl6O |
| Molecular Weight | 330.85 g/mol |
| Exact Mass | 327.85 |
| IUPAC Name | chloroethane;2,3,4,5,6-pentachlorophenol |
| SMILES | CCCl.Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6HCl5O.C2H5Cl/c7-1-2(8)4(10)6(12)5(11)3(1)9;1-2-3/h12H;2H2,1H3 |
| InChIKey | FMRDWGAPOYDCTE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.85 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|