About N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide
N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide (PubChem CID 88595485) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide.
Molecular Properties
| Compound Name | N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide |
| PubChem CID | 88595485 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide |
| SMILES | C=C(C)C(=O)NCCCC.CC/C=C(\C)C(N)=O |
| InChI | InChI=1S/C8H15NO.C6H11NO/c1-4-5-6-9-8(10)7(2)3;1-3-4-5(2)6(7)8/h2,4-6H2,1,3H3,(H,9,10);4H,3H2,1-2H3,(H2,7,8)/b;5-4+ |
| InChIKey | SPHLTKCSJKFXEA-RCKHEGBHSA-N |
| XLogP | 2.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide?
The IUPAC name of N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide (CID 88595485) is N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide.
What is the SMILES notation for N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide?
The canonical SMILES for N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide is C=C(C)C(=O)NCCCC.CC/C=C(\C)C(N)=O.
What is the InChIKey of N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide?
The InChIKey is SPHLTKCSJKFXEA-RCKHEGBHSA-N. The full InChI is InChI=1S/C8H15NO.C6H11NO/c1-4-5-6-9-8(10)7(2)3;1-3-4-5(2)6(7)8/h2,4-6H2,1,3H3,(H,9,10);4H,3H2,1-2H3,(H2,7,8)/b;5-4+.
What are the key properties of N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide?
N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide has a molecular weight of 254.37 g/mol, XLogP of 2.31, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-methylprop-2-enamide;(E)-2-methylpent-2-enamide is sourced from PubChem (CID 88595485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).