About butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride
butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride (PubChem CID 88595496) has the molecular formula C10H22ClNO2
and a molecular weight of 223.74 g/mol. Its IUPAC name is butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride.
Molecular Properties
| Compound Name | butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride |
| PubChem CID | 88595496 |
| Molecular Formula | C10H22ClNO2 |
| Molecular Weight | 223.74 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride |
| SMILES | C=CC[N+](C)(C)C.CCCC(=O)[O-].Cl |
| InChI | InChI=1S/C6H14N.C4H8O2.ClH/c1-5-6-7(2,3)4;1-2-3-4(5)6;/h5H,1,6H2,2-4H3;2-3H2,1H3,(H,5,6);1H/q+1;;/p-1 |
| InChIKey | GLHFSNBKWSRIKJ-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.74 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride?
The IUPAC name of butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride (CID 88595496) is butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride.
What is the SMILES notation for butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride?
The canonical SMILES for butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride is C=CC[N+](C)(C)C.CCCC(=O)[O-].Cl.
What is the InChIKey of butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride?
The InChIKey is GLHFSNBKWSRIKJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14N.C4H8O2.ClH/c1-5-6-7(2,3)4;1-2-3-4(5)6;/h5H,1,6H2,2-4H3;2-3H2,1H3,(H,5,6);1H/q+1;;/p-1.
What are the key properties of butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride?
butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride has a molecular weight of 223.74 g/mol, XLogP of 0.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;trimethyl(prop-2-enyl)azanium;hydrochloride is sourced from PubChem (CID 88595496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).