About N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene (PubChem CID 88595733) has the molecular formula C14H28N4O3
and a molecular weight of 300.40 g/mol. Its IUPAC name is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene.
Molecular Properties
| Compound Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene |
| PubChem CID | 88595733 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene |
| SMILES | C=C(C)C.NCCNCCNCCN.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C6H18N4.C4H2O3.C4H8/c7-1-3-9-5-6-10-4-2-8;5-3-1-2-4(6)7-3;1-4(2)3/h9-10H,1-8H2;1-2H;1H2,2-3H3 |
| InChIKey | XBBSUVAPJOUKAG-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene?
The IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene (CID 88595733) is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene.
What is the SMILES notation for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene?
The canonical SMILES for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene is C=C(C)C.NCCNCCNCCN.O=C1C=CC(=O)O1.
What is the InChIKey of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene?
The InChIKey is XBBSUVAPJOUKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N4.C4H2O3.C4H8/c7-1-3-9-5-6-10-4-2-8;5-3-1-2-4(6)7-3;1-4(2)3/h9-10H,1-8H2;1-2H;1H2,2-3H3.
What are the key properties of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene?
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene has a molecular weight of 300.40 g/mol, XLogP of -0.71, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione;2-methylprop-1-ene is sourced from PubChem (CID 88595733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).