C57H64O8P2Si — CID 88595879
(1R,2R,3R,4R,5R,6S)-1,4-dibenzyl-2,3-bis(dibenzylphosphoryl)-5-tris(prop-2-enyl)silylcyclohexane-1,2,3,4,5,6-hexol (PubChem CID 88595879) has the molecular formula C57H64O8P2Si and a molecular weight of 967.17 g/mol. Its IUPAC name is (1R,2R,3R,4R,5R,6S)-1,4-dibenzyl-2,3-bis(dibenzylphosphoryl)-5-tris(prop-2-enyl)silylcyclohexane-1,2,3,4,5,6-hexol.
| Compound Name | (1R,2R,3R,4R,5R,6S)-1,4-dibenzyl-2,3-bis(dibenzylphosphoryl)-5-tris(prop-2-enyl)silylcyclohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 88595879 |
| Molecular Formula | C57H64O8P2Si |
| Molecular Weight | 967.17 g/mol |
| Exact Mass | 966.38 |
| IUPAC Name | (1R,2R,3R,4R,5R,6S)-1,4-dibenzyl-2,3-bis(dibenzylphosphoryl)-5-tris(prop-2-enyl)silylcyclohexane-1,2,3,4,5,6-hexol |
| SMILES | C=CC[Si](CC=C)(CC=C)[C@]1(O)[C@@H](O)[C@](O)(Cc2ccccc2)[C@@](O)(P(=O)(Cc2ccccc2)Cc2ccccc2)[C@](O)(P(=O)(Cc2ccccc2)Cc2ccccc2)[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C57H64O8P2Si/c1-4-37-68(38-5-2,39-6-3)55(61)52(58)53(59,40-46-25-13-7-14-26-46)56(62,66(64,42-48-29-17-9-18-30-48)43-49-31-19-10-20-32-49)57(63,54(55,60)41-47-27-15-8-16-28-47)67(65,44-50-33-21-11-22-34-50)45-51-35-23-12-24-36-51/h4-36,52,58-63H,1-3,37-45H2/t52-,53+,54+,55+,56+,57+/m0/s1 |
| InChIKey | FQVACSKZHHHVFA-WENJDJJQSA-N |
| XLogP | 10.49 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.17 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|